Products 2750534-74-6
CAS 2750534-74-6 appears in our catalog under these names: 15(S)–HEPE–d5, 15(S)-HEPE-d5. Offered by: GLPBio, MedChemExpress. Available pack sizes: 100μg, 25μg, 50μg, 5mg, 1mg.
(5Z,8Z,11Z,13E,15S,17Z)-19,19,20,20,20-pentadeuterio-15-hydroxyicosa-5,8,11,13,17-pentaenoic acid (CAS 2750534-74-6) is a chemical compound with the molecular formula C20H30O3 and a molecular weight of 323.5 g/mol. IUPAC name: (5Z,8Z,11Z,13E,15S,17Z)-19,19,20,20,20-pentadeuterio-15-hydroxyicosa-5,8,11,13,17-pentaenoic acid. InChIKey: WLKCSMCLEKGITB-SUTOMXFYSA-N.
| Molecular formula | C20H30O3 |
|---|---|
| Molecular weight | 323.5 g/mol |
| IUPAC name | (5Z,8Z,11Z,13E,15S,17Z)-19,19,20,20,20-pentadeuterio-15-hydroxyicosa-5,8,11,13,17-pentaenoic acid |
| InChIKey | WLKCSMCLEKGITB-SUTOMXFYSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])/C=C\C[C@@H](/C=C/C=C\C/C=C\C/C=C\CCCC(=O)O)O |
Computed by PubChem (NCBI)