Products 2752460-78-7
CAS 2752460-78-7 is the registry number for 3-Phenylazetidine hemioxalate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Oxalic acid;bis(3-phenylazetidine) (CAS 2752460-78-7) is a chemical compound with the molecular formula C20H24N2O4 and a molecular weight of 356.4 g/mol. IUPAC name: oxalic acid;bis(3-phenylazetidine). InChIKey: YADXJOOKPMCUBF-UHFFFAOYSA-N.
| Molecular formula | C20H24N2O4 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | oxalic acid;bis(3-phenylazetidine) |
| InChIKey | YADXJOOKPMCUBF-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=CC=CC=C2.C1C(CN1)C2=CC=CC=C2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)