Products 2752466-36-5

CAS 2752466-36-5 is the registry number for Angiogenesis inhibitor 6. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

Ethyl 3-[2-(4-methoxyphenyl)ethyl]-2H-azirine-2-carboxylate (CAS 2752466-36-5) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: ethyl 3-[2-(4-methoxyphenyl)ethyl]-2H-azirine-2-carboxylate. InChIKey: GGHXVCZZJLKAJE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17NO3
Molecular weight247.29 g/mol
IUPAC nameethyl 3-[2-(4-methoxyphenyl)ethyl]-2H-azirine-2-carboxylate
InChIKeyGGHXVCZZJLKAJE-UHFFFAOYSA-N
SMILESCCOC(=O)C1C(=N1)CCC2=CC=C(C=C2)OC

Computed by PubChem (NCBI)