CAS 2754409-94-2 is the registry number for tert-Butyl (3-bromo-2,4-difluorophenyl)(tert-butoxycarbonyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(3-bromo-2,4-difluorophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 2754409-94-2) is a chemical compound with the molecular formula C16H20BrF2NO4 and a molecular weight of 408.23 g/mol. IUPAC name: tert-butyl N-(3-bromo-2,4-difluorophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: OUPLAPISSXOBOY-UHFFFAOYSA-N.
| Molecular formula | C16H20BrF2NO4 |
|---|---|
| Molecular weight | 408.23 g/mol |
| IUPAC name | tert-butyl N-(3-bromo-2,4-difluorophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | OUPLAPISSXOBOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=C(C(=C(C=C1)F)Br)F)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)