CAS 2807466-05-1 is the registry number for 1,3-Bis(1,1-dimethylethyl) 2-(4-bromo-2,5-difluorophenyl)imidodicarbonate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl N-(4-bromo-2,5-difluorophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 2807466-05-1) is a chemical compound with the molecular formula C16H20BrF2NO4 and a molecular weight of 408.23 g/mol. IUPAC name: tert-butyl N-(4-bromo-2,5-difluorophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: REAOZTLLXYXVJU-UHFFFAOYSA-N.
| Molecular formula | C16H20BrF2NO4 |
|---|---|
| Molecular weight | 408.23 g/mol |
| IUPAC name | tert-butyl N-(4-bromo-2,5-difluorophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | REAOZTLLXYXVJU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=CC(=C(C=C1F)Br)F)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)