Products 2755718-69-3
CAS 2755718-69-3 is the registry number for 3-Hydroxy-3-mesityl-N-methoxy-N-methylpropanamide, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
3-hydroxy-N-methoxy-N-methyl-3-(2,4,6-trimethylphenyl)propanamide (CAS 2755718-69-3) is a chemical compound with the molecular formula C14H21NO3 and a molecular weight of 251.32 g/mol. IUPAC name: 3-hydroxy-N-methoxy-N-methyl-3-(2,4,6-trimethylphenyl)propanamide. InChIKey: SMTIIDLWUFHSTF-UHFFFAOYSA-N.
| Molecular formula | C14H21NO3 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | 3-hydroxy-N-methoxy-N-methyl-3-(2,4,6-trimethylphenyl)propanamide |
| InChIKey | SMTIIDLWUFHSTF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(CC(=O)N(C)OC)O)C |
Computed by PubChem (NCBI)