Products 2755814-80-1
CAS 2755814-80-1 is the registry number for Antiviral agent 14. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]-2-oxoethyl] (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate (CAS 2755814-80-1) is a chemical compound with the molecular formula C24H26O7 and a molecular weight of 426.5 g/mol. IUPAC name: [2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]-2-oxoethyl] (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate. InChIKey: CCMZWBKRFRMNOV-XZUSAQEFSA-N.
| Molecular formula | C24H26O7 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | [2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]-2-oxoethyl] (E)-3-(4-ethoxy-3-methoxyphenyl)prop-2-enoate |
| InChIKey | CCMZWBKRFRMNOV-XZUSAQEFSA-N |
| SMILES | CCOC1=C(C=C(C=C1)/C=C/C(=O)OCC(=O)OC2=C(C=C(C=C2)/C=C/C)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
Antiviral agent 14, orb1687733