Products 2755950-83-3
CAS 2755950-83-3 is the registry number for Methyl (2S)-2-amino-3-(6,6-dimethyl-2-oxopiperidin-3-yl)propanoate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-amino-3-(6,6-dimethyl-2-oxopiperidin-3-yl)propanoate;hydrochloride (CAS 2755950-83-3) is a chemical compound with the molecular formula C11H21ClN2O3 and a molecular weight of 264.75 g/mol. IUPAC name: methyl (2S)-2-amino-3-(6,6-dimethyl-2-oxopiperidin-3-yl)propanoate;hydrochloride. InChIKey: KHSABURZOCSIDI-MTICXXPYSA-N.
| Molecular formula | C11H21ClN2O3 |
|---|---|
| Molecular weight | 264.75 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(6,6-dimethyl-2-oxopiperidin-3-yl)propanoate;hydrochloride |
| InChIKey | KHSABURZOCSIDI-MTICXXPYSA-N |
| SMILES | CC1(CCC(C(=O)N1)C[C@@H](C(=O)OC)N)C.Cl |
Computed by PubChem (NCBI)