CAS 2918775-86-5 appears in our catalog under these names: tert-Butyl (R)-7-amino-5-oxa-2-azaspiro(3.4)octane-2-carboxylate hydrochloride, 95%, tert-butyl (7R)-7-amino-5-oxa-2-azaspiro[3.4]octane-2-carboxylate,hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
Tert-butyl (7R)-7-amino-5-oxa-2-azaspiro[3.4]octane-2-carboxylate;hydrochloride (CAS 2918775-86-5) is a chemical compound with the molecular formula C11H21ClN2O3 and a molecular weight of 264.75 g/mol. IUPAC name: tert-butyl (7R)-7-amino-5-oxa-2-azaspiro[3.4]octane-2-carboxylate;hydrochloride. InChIKey: FZTYQLQXIFUFKS-DDWIOCJRSA-N.
| Molecular formula | C11H21ClN2O3 |
|---|---|
| Molecular weight | 264.75 g/mol |
| IUPAC name | tert-butyl (7R)-7-amino-5-oxa-2-azaspiro[3.4]octane-2-carboxylate;hydrochloride |
| InChIKey | FZTYQLQXIFUFKS-DDWIOCJRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)C[C@H](CO2)N.Cl |
Computed by PubChem (NCBI)