CAS 2756-79-8 is the registry number for 2,6–Di–tert–butyl–4–methyl–4–allyl–cyclohexa–2,5–dien–1–one. Offered by: GLPBio. Available pack sizes: 50mg.
2,6-ditert-butyl-4-methyl-4-prop-2-enylcyclohexa-2,5-dien-1-one (CAS 2756-79-8) is a chemical compound with the molecular formula C18H28O and a molecular weight of 260.4 g/mol. IUPAC name: 2,6-ditert-butyl-4-methyl-4-prop-2-enylcyclohexa-2,5-dien-1-one. InChIKey: MMQFLRHQCHIIPU-UHFFFAOYSA-N.
| Molecular formula | C18H28O |
|---|---|
| Molecular weight | 260.4 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-methyl-4-prop-2-enylcyclohexa-2,5-dien-1-one |
| InChIKey | MMQFLRHQCHIIPU-UHFFFAOYSA-N |
| SMILES | CC1(C=C(C(=O)C(=C1)C(C)(C)C)C(C)(C)C)CC=C |
Computed by PubChem (NCBI)