CAS 2918917-56-1 is the registry number for 1-(3-(tert-butyl)phenyl)-4,4-dimethylcyclohexanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-tert-butylphenyl)-4,4-dimethylcyclohexan-1-ol (CAS 2918917-56-1) is a chemical compound with the molecular formula C18H28O and a molecular weight of 260.4 g/mol. IUPAC name: 1-(3-tert-butylphenyl)-4,4-dimethylcyclohexan-1-ol. InChIKey: DYHPWDWGGZEUJM-UHFFFAOYSA-N.
| Molecular formula | C18H28O |
|---|---|
| Molecular weight | 260.4 g/mol |
| IUPAC name | 1-(3-tert-butylphenyl)-4,4-dimethylcyclohexan-1-ol |
| InChIKey | DYHPWDWGGZEUJM-UHFFFAOYSA-N |
| SMILES | CC1(CCC(CC1)(C2=CC(=CC=C2)C(C)(C)C)O)C |
Computed by PubChem (NCBI)