Products 2757083-44-4
CAS 2757083-44-4 is the registry number for 7-Amino-6-bromo-2,3-dihydro-1H-indene-4-carbonitrile, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 100mg.
7-amino-6-bromo-2,3-dihydro-1H-indene-4-carbonitrile (CAS 2757083-44-4) is a chemical compound with the molecular formula C10H9BrN2 and a molecular weight of 237.10 g/mol. IUPAC name: 7-amino-6-bromo-2,3-dihydro-1H-indene-4-carbonitrile. InChIKey: OYZLBNIGUZINDV-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2 |
|---|---|
| Molecular weight | 237.10 g/mol |
| IUPAC name | 7-amino-6-bromo-2,3-dihydro-1H-indene-4-carbonitrile |
| InChIKey | OYZLBNIGUZINDV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=C(C=C2C#N)Br)N |
Computed by PubChem (NCBI)