Products 2757085-21-3
CAS 2757085-21-3 is the registry number for (R)-4-Cyclohexyl-2-(pyridin-2-ylmethyl)-4,5-dihydrooxazole, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 100mg.
(4R)-4-cyclohexyl-2-(pyridin-2-ylmethyl)-4,5-dihydro-1,3-oxazole (CAS 2757085-21-3) is a chemical compound with the molecular formula C15H20N2O and a molecular weight of 244.33 g/mol. IUPAC name: (4R)-4-cyclohexyl-2-(pyridin-2-ylmethyl)-4,5-dihydro-1,3-oxazole. InChIKey: WEVUVWCNBXGKDF-AWEZNQCLSA-N.
| Molecular formula | C15H20N2O |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | (4R)-4-cyclohexyl-2-(pyridin-2-ylmethyl)-4,5-dihydro-1,3-oxazole |
| InChIKey | WEVUVWCNBXGKDF-AWEZNQCLSA-N |
| SMILES | C1CCC(CC1)[C@@H]2COC(=N2)CC3=CC=CC=N3 |
Computed by PubChem (NCBI)