Products 2757679-07-3
CAS 2757679-07-3 is the registry number for 1-(7-Chloro-1,6-naphthyridin-2-yl)ethan-1-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(7-chloro-1,6-naphthyridin-2-yl)ethanone (CAS 2757679-07-3) is a chemical compound with the molecular formula C10H7ClN2O and a molecular weight of 206.63 g/mol. IUPAC name: 1-(7-chloro-1,6-naphthyridin-2-yl)ethanone. InChIKey: ZUPPZWBLBRTECL-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O |
|---|---|
| Molecular weight | 206.63 g/mol |
| IUPAC name | 1-(7-chloro-1,6-naphthyridin-2-yl)ethanone |
| InChIKey | ZUPPZWBLBRTECL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NC2=CC(=NC=C2C=C1)Cl |
Computed by PubChem (NCBI)