CAS 2758045-24-6 is the registry number for rel-(2R,4R)-2-(Trifluoromethyl)tetrahydro-2H-pyran-4-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,4R)-2-(trifluoromethyl)oxan-4-ol (CAS 2758045-24-6) is a chemical compound with the molecular formula C6H9F3O2 and a molecular weight of 170.13 g/mol. IUPAC name: (2R,4R)-2-(trifluoromethyl)oxan-4-ol. InChIKey: WMARCHQQOZHEKC-RFZPGFLSSA-N.
| Molecular formula | C6H9F3O2 |
|---|---|
| Molecular weight | 170.13 g/mol |
| IUPAC name | (2R,4R)-2-(trifluoromethyl)oxan-4-ol |
| InChIKey | WMARCHQQOZHEKC-RFZPGFLSSA-N |
| SMILES | C1CO[C@H](C[C@@H]1O)C(F)(F)F |
Computed by PubChem (NCBI)