CAS 275815-80-0 appears in our catalog under these names: (S)-3-(4-Fluorobenzyl)piperidine, 98+%, (S)–3–(4–Fluorobenzyl)Piperidine. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(3S)-3-[(4-fluorophenyl)methyl]piperidine (CAS 275815-80-0) is a chemical compound with the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. IUPAC name: (3S)-3-[(4-fluorophenyl)methyl]piperidine. InChIKey: WATWKPHWUDHKGA-NSHDSACASA-N.
| Molecular formula | C12H16FN |
|---|---|
| Molecular weight | 193.26 g/mol |
| IUPAC name | (3S)-3-[(4-fluorophenyl)methyl]piperidine |
| InChIKey | WATWKPHWUDHKGA-NSHDSACASA-N |
| SMILES | C1C[C@H](CNC1)CC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)