CAS 27582-14-5 appears in our catalog under these names: 4-Amino-2-methyl-3-nitropyridine 95%, 4-Amino-2-methyl-3-nitropyridine, 95%, 95%, 4-Amino-2-methyl-3-nitropyridine, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
2-methyl-3-nitropyridin-4-amine (CAS 27582-14-5) is a chemical compound with the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. IUPAC name: 2-methyl-3-nitropyridin-4-amine. InChIKey: PWMOQGXCXFHJMF-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O2 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 2-methyl-3-nitropyridin-4-amine |
| InChIKey | PWMOQGXCXFHJMF-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC(=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)