Products 275821-04-0
CAS 275821-04-0 is the registry number for 2',5'-Dideoxy-8,5'-cycloadenosine. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg.
7-amino-15-oxa-2,4,6,9-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-3,5,7,9-tetraen-13-ol (CAS 275821-04-0) is a chemical compound with the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. IUPAC name: 7-amino-15-oxa-2,4,6,9-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-3,5,7,9-tetraen-13-ol. InChIKey: RZVADNQLAKDQSR-UHFFFAOYSA-N.
| Molecular formula | C10H11N5O2 |
|---|---|
| Molecular weight | 233.23 g/mol |
| IUPAC name | 7-amino-15-oxa-2,4,6,9-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-3,5,7,9-tetraen-13-ol |
| InChIKey | RZVADNQLAKDQSR-UHFFFAOYSA-N |
| SMILES | C1C(C2CC3=NC4=C(N=CN=C4N3C1O2)N)O |
Computed by PubChem (NCBI)