CAS 405279-30-3 is the registry number for 5-Amino-2-(4-methoxyphenyl)-2H-1,2,3-triazole-4-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-amino-2-(4-methoxyphenyl)triazole-4-carboxamide (CAS 405279-30-3) is a chemical compound with the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. IUPAC name: 5-amino-2-(4-methoxyphenyl)triazole-4-carboxamide. InChIKey: FYCHFSWILXTROZ-UHFFFAOYSA-N.
| Molecular formula | C10H11N5O2 |
|---|---|
| Molecular weight | 233.23 g/mol |
| IUPAC name | 5-amino-2-(4-methoxyphenyl)triazole-4-carboxamide |
| InChIKey | FYCHFSWILXTROZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2N=C(C(=N2)N)C(=O)N |
Computed by PubChem (NCBI)