CAS 2643340-45-6 is the registry number for Methyl 4-(5-aminopyridin-2-yl)-1-methyl-1H-1,2,3-triazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-(5-amino-2-pyridinyl)-3-methyltriazole-4-carboxylate (CAS 2643340-45-6) is a chemical compound with the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. IUPAC name: methyl 5-(5-amino-2-pyridinyl)-3-methyltriazole-4-carboxylate. InChIKey: MWQMJKUMLRBLBN-UHFFFAOYSA-N.
| Molecular formula | C10H11N5O2 |
|---|---|
| Molecular weight | 233.23 g/mol |
| IUPAC name | methyl 5-(5-amino-2-pyridinyl)-3-methyltriazole-4-carboxylate |
| InChIKey | MWQMJKUMLRBLBN-UHFFFAOYSA-N |
| SMILES | CN1C(=C(N=N1)C2=NC=C(C=C2)N)C(=O)OC |
Computed by PubChem (NCBI)