Products 2758255-05-7
CAS 2758255-05-7 is the registry number for NMDA receptor modulator 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,4-dihydropyrazine-2,3-dione (CAS 2758255-05-7) is a chemical compound with the molecular formula C13H11F3N2O2 and a molecular weight of 284.23 g/mol. IUPAC name: 5-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,4-dihydropyrazine-2,3-dione. InChIKey: YIASGIMSIFVHQL-UHFFFAOYSA-N.
| Molecular formula | C13H11F3N2O2 |
|---|---|
| Molecular weight | 284.23 g/mol |
| IUPAC name | 5-[2-[4-(trifluoromethyl)phenyl]ethyl]-1,4-dihydropyrazine-2,3-dione |
| InChIKey | YIASGIMSIFVHQL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCC2=CNC(=O)C(=O)N2)C(F)(F)F |
Computed by PubChem (NCBI)