Products 2758305-25-6
CAS 2758305-25-6 is the registry number for 3,5,5-Trimethyl-3-(methylamino)-6-oxocyclohex-1-ene-1-carbonitrile hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
3,5,5-trimethyl-3-(methylamino)-6-oxocyclohexene-1-carbonitrile;hydrochloride (CAS 2758305-25-6) is a chemical compound with the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. IUPAC name: 3,5,5-trimethyl-3-(methylamino)-6-oxocyclohexene-1-carbonitrile;hydrochloride. InChIKey: JWCWUCGJXCQXMW-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O |
|---|---|
| Molecular weight | 228.72 g/mol |
| IUPAC name | 3,5,5-trimethyl-3-(methylamino)-6-oxocyclohexene-1-carbonitrile;hydrochloride |
| InChIKey | JWCWUCGJXCQXMW-UHFFFAOYSA-N |
| SMILES | CC1(CC(C=C(C1=O)C#N)(C)NC)C.Cl |
Computed by PubChem (NCBI)