Products 2758432-00-5
CAS 2758432-00-5 is the registry number for Thalidomide-O-C3-azide. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg.
4-(3-azidopropoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 2758432-00-5) is a chemical compound with the molecular formula C16H15N5O5 and a molecular weight of 357.32 g/mol. IUPAC name: 4-(3-azidopropoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: FSVXNXHJEDNHGP-UHFFFAOYSA-N.
| Molecular formula | C16H15N5O5 |
|---|---|
| Molecular weight | 357.32 g/mol |
| IUPAC name | 4-(3-azidopropoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | FSVXNXHJEDNHGP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)OCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)