CAS 923173-81-3 is the registry number for 3,5-dinitrophenyl 4-(2-pyridyl)piperazinyl ketone. Offered by: Biosynth. Available pack sizes: 250mg.
(3,5-dinitrophenyl)-(4-pyridin-2-ylpiperazin-1-yl)methanone (CAS 923173-81-3) is a chemical compound with the molecular formula C16H15N5O5 and a molecular weight of 357.32 g/mol. IUPAC name: (3,5-dinitrophenyl)-(4-pyridin-2-ylpiperazin-1-yl)methanone. InChIKey: IHNLEZUFSZIHTI-UHFFFAOYSA-N.
| Molecular formula | C16H15N5O5 |
|---|---|
| Molecular weight | 357.32 g/mol |
| IUPAC name | (3,5-dinitrophenyl)-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| InChIKey | IHNLEZUFSZIHTI-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=CC=N2)C(=O)C3=CC(=CC(=C3)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)