CAS 2758655-01-3 is the registry number for tert-Butyl 4-(hydroxymethyl)-5,7-dimethyl-1H-indole-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-(hydroxymethyl)-5,7-dimethylindole-1-carboxylate (CAS 2758655-01-3) is a chemical compound with the molecular formula C16H21NO3 and a molecular weight of 275.34 g/mol. IUPAC name: tert-butyl 4-(hydroxymethyl)-5,7-dimethylindole-1-carboxylate. InChIKey: KAPOBJFSYMDGQV-UHFFFAOYSA-N.
| Molecular formula | C16H21NO3 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | tert-butyl 4-(hydroxymethyl)-5,7-dimethylindole-1-carboxylate |
| InChIKey | KAPOBJFSYMDGQV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1CO)C=CN2C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)