CAS 2759197-55-0 is the registry number for 6'-Chloro-[2,2'-bipyridin]-6-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(6-chloro-2-pyridinyl)-1H-pyridin-2-one (CAS 2759197-55-0) is a chemical compound with the molecular formula C10H7ClN2O and a molecular weight of 206.63 g/mol. IUPAC name: 6-(6-chloro-2-pyridinyl)-1H-pyridin-2-one. InChIKey: KJAVIAFEABDAET-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O |
|---|---|
| Molecular weight | 206.63 g/mol |
| IUPAC name | 6-(6-chloro-2-pyridinyl)-1H-pyridin-2-one |
| InChIKey | KJAVIAFEABDAET-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)C2=CC=CC(=O)N2 |
Computed by PubChem (NCBI)