Products 2759197-62-9
CAS 2759197-62-9 is the registry number for 6-(2-(Quinolin-2-yl)propan-2-yl)pyridin-2(1H)-one, 98%. Offered by: Ambeed, Fluorochem, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg, 5g.
6-(2-quinolin-2-ylpropan-2-yl)-1H-pyridin-2-one (CAS 2759197-62-9) is a chemical compound with the molecular formula C17H16N2O and a molecular weight of 264.32 g/mol. IUPAC name: 6-(2-quinolin-2-ylpropan-2-yl)-1H-pyridin-2-one. InChIKey: CIRLZTHQOBXUTN-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | 6-(2-quinolin-2-ylpropan-2-yl)-1H-pyridin-2-one |
| InChIKey | CIRLZTHQOBXUTN-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NC2=CC=CC=C2C=C1)C3=CC=CC(=O)N3 |
Computed by PubChem (NCBI)