Products 2759901-85-2
CAS 2759901-85-2 is the registry number for Methyl 2-(2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate (CAS 2759901-85-2) is a chemical compound with the molecular formula C15H19BF2O4 and a molecular weight of 312.12 g/mol. IUPAC name: methyl 2-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate. InChIKey: UBCQKRHMUURVCS-UHFFFAOYSA-N.
| Molecular formula | C15H19BF2O4 |
|---|---|
| Molecular weight | 312.12 g/mol |
| IUPAC name | methyl 2-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
| InChIKey | UBCQKRHMUURVCS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)CC(=O)OC)F |
Computed by PubChem (NCBI)