CAS 1198615-67-6 appears in our catalog under these names: Ethyl 2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 98%, 98%, 2,6-Difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-benzoic acid ethyl ester, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.
Ethyl 2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1198615-67-6) is a chemical compound with the molecular formula C15H19BF2O4 and a molecular weight of 312.12 g/mol. IUPAC name: ethyl 2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: OIPFEQUBDKMBHY-UHFFFAOYSA-N.
| Molecular formula | C15H19BF2O4 |
|---|---|
| Molecular weight | 312.12 g/mol |
| IUPAC name | ethyl 2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | OIPFEQUBDKMBHY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)C(=O)OCC)F |
Computed by PubChem (NCBI)