CAS 1334164-30-5 appears in our catalog under these names: 2-(Ethoxycarbonyl)-4,5-difluorophenylboronic acid pinacol ester, 97%, 97%, Ethyl 4,5-difluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 95+%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg.
Ethyl 4,5-difluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1334164-30-5) is a chemical compound with the molecular formula C15H19BF2O4 and a molecular weight of 312.12 g/mol. IUPAC name: ethyl 4,5-difluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: FWIZTURUCKHPCI-UHFFFAOYSA-N.
| Molecular formula | C15H19BF2O4 |
|---|---|
| Molecular weight | 312.12 g/mol |
| IUPAC name | ethyl 4,5-difluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | FWIZTURUCKHPCI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2C(=O)OCC)F)F |
Computed by PubChem (NCBI)