CAS 2760368-95-2 is the registry number for rel-(2R,4S,5R)-4-Isopropoxy-5-methyl-2-phenylpiperidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,4S,5R)-5-methyl-2-phenyl-4-propan-2-yloxypiperidine (CAS 2760368-95-2) is a chemical compound with the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. IUPAC name: (2R,4S,5R)-5-methyl-2-phenyl-4-propan-2-yloxypiperidine. InChIKey: FDRKZWJRMYHVSI-YUELXQCFSA-N.
| Molecular formula | C15H23NO |
|---|---|
| Molecular weight | 233.35 g/mol |
| IUPAC name | (2R,4S,5R)-5-methyl-2-phenyl-4-propan-2-yloxypiperidine |
| InChIKey | FDRKZWJRMYHVSI-YUELXQCFSA-N |
| SMILES | C[C@@H]1CN[C@H](C[C@@H]1OC(C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)