CAS 728042-52-2 is the registry number for 2-Amino-3,5-di-tert-butylbenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-amino-3,5-ditert-butylbenzaldehyde (CAS 728042-52-2) is a chemical compound with the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. IUPAC name: 2-amino-3,5-ditert-butylbenzaldehyde. InChIKey: OBOCJRZPVBLYJE-UHFFFAOYSA-N.
| Molecular formula | C15H23NO |
|---|---|
| Molecular weight | 233.35 g/mol |
| IUPAC name | 2-amino-3,5-ditert-butylbenzaldehyde |
| InChIKey | OBOCJRZPVBLYJE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)N)C=O |
Computed by PubChem (NCBI)