CAS 2760487-38-3 is the registry number for rel-5-((2R,5S)-5-Methylpiperidin-2-yl)isoindolin-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(2R,5S)-5-methylpiperidin-2-yl]-2,3-dihydroisoindol-1-one (CAS 2760487-38-3) is a chemical compound with the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. IUPAC name: 5-[(2R,5S)-5-methylpiperidin-2-yl]-2,3-dihydroisoindol-1-one. InChIKey: OYGQIHBVHBSSLR-TVQRCGJNSA-N.
| Molecular formula | C14H18N2O |
|---|---|
| Molecular weight | 230.31 g/mol |
| IUPAC name | 5-[(2R,5S)-5-methylpiperidin-2-yl]-2,3-dihydroisoindol-1-one |
| InChIKey | OYGQIHBVHBSSLR-TVQRCGJNSA-N |
| SMILES | C[C@H]1CC[C@@H](NC1)C2=CC3=C(C=C2)C(=O)NC3 |
Computed by PubChem (NCBI)