Products 2760566-20-7
CAS 2760566-20-7 is the registry number for rel-2-((2S,6S)-2-Methyl-6-phenylpiperidin-1-yl)-2-oxoacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2S,6S)-2-methyl-6-phenylpiperidin-1-yl]-2-oxoacetic acid (CAS 2760566-20-7) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: 2-[(2S,6S)-2-methyl-6-phenylpiperidin-1-yl]-2-oxoacetic acid. InChIKey: IMILXWJOFCKFMA-JQWIXIFHSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 2-[(2S,6S)-2-methyl-6-phenylpiperidin-1-yl]-2-oxoacetic acid |
| InChIKey | IMILXWJOFCKFMA-JQWIXIFHSA-N |
| SMILES | C[C@H]1CCC[C@H](N1C(=O)C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)