CAS 2760669-84-7 is the registry number for Factor B-IN-4. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
4-[(2S,4S)-1-[(7-cyclopropyl-5-methoxy-1H-indol-4-yl)methyl]-4-ethoxypiperidin-2-yl]benzoic acid (CAS 2760669-84-7) is a chemical compound with the molecular formula C27H32N2O4 and a molecular weight of 448.6 g/mol. IUPAC name: 4-[(2S,4S)-1-[(7-cyclopropyl-5-methoxy-1H-indol-4-yl)methyl]-4-ethoxypiperidin-2-yl]benzoic acid. InChIKey: ZZLHVLINQSBHSO-RDPSFJRHSA-N.
| Molecular formula | C27H32N2O4 |
|---|---|
| Molecular weight | 448.6 g/mol |
| IUPAC name | 4-[(2S,4S)-1-[(7-cyclopropyl-5-methoxy-1H-indol-4-yl)methyl]-4-ethoxypiperidin-2-yl]benzoic acid |
| InChIKey | ZZLHVLINQSBHSO-RDPSFJRHSA-N |
| SMILES | CCO[C@H]1CCN([C@@H](C1)C2=CC=C(C=C2)C(=O)O)CC3=C(C=C(C4=C3C=CN4)C5CC5)OC |
Computed by PubChem (NCBI)