CAS 2797066-85-2 is the registry number for Lanoracopan. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 50 mg, 1 mg, 5 mg.
4-[(2S,4S)-4-(cyclopropylmethoxy)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid (CAS 2797066-85-2) is a chemical compound with the molecular formula C27H32N2O4 and a molecular weight of 448.6 g/mol. IUPAC name: 4-[(2S,4S)-4-(cyclopropylmethoxy)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid. InChIKey: YJJUEZFALZMWAP-URXFXBBRSA-N.
| Molecular formula | C27H32N2O4 |
|---|---|
| Molecular weight | 448.6 g/mol |
| IUPAC name | 4-[(2S,4S)-4-(cyclopropylmethoxy)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]piperidin-2-yl]benzoic acid |
| InChIKey | YJJUEZFALZMWAP-URXFXBBRSA-N |
| SMILES | CC1=CC(=C(C2=C1NC=C2)CN3CC[C@@H](C[C@H]3C4=CC=C(C=C4)C(=O)O)OCC5CC5)OC |
Computed by PubChem (NCBI)