Products 2761367-25-1
CAS 2761367-25-1 is the registry number for Antiviral agent 25. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-fluorophenyl)-N-methyl-2-phenyl-1,2,4-thiadiazol-5-imine (CAS 2761367-25-1) is a chemical compound with the molecular formula C15H12FN3S and a molecular weight of 285.3 g/mol. IUPAC name: 3-(4-fluorophenyl)-N-methyl-2-phenyl-1,2,4-thiadiazol-5-imine. InChIKey: YBCTXELRRVXUMP-UHFFFAOYSA-N.
| Molecular formula | C15H12FN3S |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-N-methyl-2-phenyl-1,2,4-thiadiazol-5-imine |
| InChIKey | YBCTXELRRVXUMP-UHFFFAOYSA-N |
| SMILES | CN=C1N=C(N(S1)C2=CC=CC=C2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)
Synonyms:
Antiviral agent 25, orb1982359