CAS 54543-42-9 is the registry number for 5-(4-Fluorophenyl)-4-(4-methylphenyl)-4H-1,2,4-triazole-3-thiol. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
3-(4-fluorophenyl)-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione (CAS 54543-42-9) is a chemical compound with the molecular formula C15H12FN3S and a molecular weight of 285.3 g/mol. IUPAC name: 3-(4-fluorophenyl)-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione. InChIKey: MYUUGTKXLGVPMV-UHFFFAOYSA-N.
| Molecular formula | C15H12FN3S |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | MYUUGTKXLGVPMV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=NNC2=S)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)