CAS 2761546-37-4 is the registry number for 1-(5-Amino-3-phenyl-1H-pyrazol-1-yl)-2,2-dimethylpropan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5-amino-3-phenylpyrazol-1-yl)-2,2-dimethylpropan-1-one (CAS 2761546-37-4) is a chemical compound with the molecular formula C14H17N3O and a molecular weight of 243.30 g/mol. IUPAC name: 1-(5-amino-3-phenylpyrazol-1-yl)-2,2-dimethylpropan-1-one. InChIKey: GCDKBEVTALNFDR-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 1-(5-amino-3-phenylpyrazol-1-yl)-2,2-dimethylpropan-1-one |
| InChIKey | GCDKBEVTALNFDR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)N1C(=CC(=N1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)