CAS 27618-10-6 is the registry number for 2-Amino-4-benzylphenol, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-amino-4-benzylphenol (CAS 27618-10-6) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 2-amino-4-benzylphenol. InChIKey: KELKWZKNBJTIRP-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 2-amino-4-benzylphenol |
| InChIKey | KELKWZKNBJTIRP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=C(C=C2)O)N |
Computed by PubChem (NCBI)