CAS 2762044-47-1 is the registry number for Rel-(1s,4s)-4-(methoxycarbonyl)-1,4-dimethylcyclohexane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methoxycarbonyl-1,4-dimethylcyclohexane-1-carboxylic acid (CAS 2762044-47-1) is a chemical compound with the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. IUPAC name: 4-methoxycarbonyl-1,4-dimethylcyclohexane-1-carboxylic acid. InChIKey: HUYZWIMGIIXGIY-UHFFFAOYSA-N.
| Molecular formula | C11H18O4 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 4-methoxycarbonyl-1,4-dimethylcyclohexane-1-carboxylic acid |
| InChIKey | HUYZWIMGIIXGIY-UHFFFAOYSA-N |
| SMILES | CC1(CCC(CC1)(C)C(=O)OC)C(=O)O |
Computed by PubChem (NCBI)