Products 2762382-51-2
CAS 2762382-51-2 is the registry number for Tubulin inhibitor 18. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(3-tert-butyl-2-hydroxyphenyl)-1-(2,4,6-trimethoxyphenyl)prop-2-en-1-one (CAS 2762382-51-2) is a chemical compound with the molecular formula C22H26O5 and a molecular weight of 370.4 g/mol. IUPAC name: (E)-3-(3-tert-butyl-2-hydroxyphenyl)-1-(2,4,6-trimethoxyphenyl)prop-2-en-1-one. InChIKey: IZJUYBUUCXVDJD-ZHACJKMWSA-N.
| Molecular formula | C22H26O5 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | (E)-3-(3-tert-butyl-2-hydroxyphenyl)-1-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
| InChIKey | IZJUYBUUCXVDJD-ZHACJKMWSA-N |
| SMILES | CC(C)(C)C1=CC=CC(=C1O)/C=C/C(=O)C2=C(C=C(C=C2OC)OC)OC |
Computed by PubChem (NCBI)