CAS 2762499-38-5 is the registry number for FQI2-34. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-[4-(dimethylamino)-2-ethoxyphenyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one (CAS 2762499-38-5) is a chemical compound with the molecular formula C20H20N2O4 and a molecular weight of 352.4 g/mol. IUPAC name: 8-[4-(dimethylamino)-2-ethoxyphenyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one. InChIKey: AOAHNHDKGGUAMF-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O4 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 8-[4-(dimethylamino)-2-ethoxyphenyl]-5H-[1,3]dioxolo[4,5-g]quinolin-6-one |
| InChIKey | AOAHNHDKGGUAMF-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)N(C)C)C2=CC(=O)NC3=CC4=C(C=C23)OCO4 |
Computed by PubChem (NCBI)