CAS 2763155-31-1 is the registry number for Ethyl 3-(3-chloro-5-(trifluoromethyl)pyridin-2-yl)-1,2,4-oxadiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1,2,4-oxadiazole-5-carboxylate (CAS 2763155-31-1) is a chemical compound with the molecular formula C11H7ClF3N3O3 and a molecular weight of 321.64 g/mol. IUPAC name: ethyl 3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1,2,4-oxadiazole-5-carboxylate. InChIKey: QLSPXRNNUBNFJJ-UHFFFAOYSA-N.
| Molecular formula | C11H7ClF3N3O3 |
|---|---|
| Molecular weight | 321.64 g/mol |
| IUPAC name | ethyl 3-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1,2,4-oxadiazole-5-carboxylate |
| InChIKey | QLSPXRNNUBNFJJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NO1)C2=C(C=C(C=N2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)