Products 346424-19-9
CAS 346424-19-9 is the registry number for Carfentrazone-benzoic Acid. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 750mg, 10mg.
2-chloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]-4-fluorobenzoic acid (CAS 346424-19-9) is a chemical compound with the molecular formula C11H7ClF3N3O3 and a molecular weight of 321.64 g/mol. IUPAC name: 2-chloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]-4-fluorobenzoic acid. InChIKey: LCCVXGGZRNCCCM-UHFFFAOYSA-N.
| Molecular formula | C11H7ClF3N3O3 |
|---|---|
| Molecular weight | 321.64 g/mol |
| IUPAC name | 2-chloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]-4-fluorobenzoic acid |
| InChIKey | LCCVXGGZRNCCCM-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)N1C(F)F)C2=C(C=C(C(=C2)C(=O)O)Cl)F |
Computed by PubChem (NCBI)