CAS 2763160-25-2 is the registry number for N-(2,6-Dichloro-3-cyano-5-fluoropyridin-4-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2,6-dichloro-3-cyano-5-fluoro-4-pyridinyl)acetamide (CAS 2763160-25-2) is a chemical compound with the molecular formula C8H4Cl2FN3O and a molecular weight of 248.04 g/mol. IUPAC name: N-(2,6-dichloro-3-cyano-5-fluoro-4-pyridinyl)acetamide. InChIKey: JBMJAGHQOAVHRT-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2FN3O |
|---|---|
| Molecular weight | 248.04 g/mol |
| IUPAC name | N-(2,6-dichloro-3-cyano-5-fluoro-4-pyridinyl)acetamide |
| InChIKey | JBMJAGHQOAVHRT-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C(=NC(=C1F)Cl)Cl)C#N |
Computed by PubChem (NCBI)