CAS 2920686-81-1 is the registry number for 2,7-Dichloro-8-fluoro-4-methoxypyrido[4,3-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,7-dichloro-8-fluoro-4-methoxypyrido[4,3-d]pyrimidine (CAS 2920686-81-1) is a chemical compound with the molecular formula C8H4Cl2FN3O and a molecular weight of 248.04 g/mol. IUPAC name: 2,7-dichloro-8-fluoro-4-methoxypyrido[4,3-d]pyrimidine. InChIKey: ZXYLMZXHZZUBHF-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2FN3O |
|---|---|
| Molecular weight | 248.04 g/mol |
| IUPAC name | 2,7-dichloro-8-fluoro-4-methoxypyrido[4,3-d]pyrimidine |
| InChIKey | ZXYLMZXHZZUBHF-UHFFFAOYSA-N |
| SMILES | COC1=NC(=NC2=C(C(=NC=C21)Cl)F)Cl |
Computed by PubChem (NCBI)