CAS 2763780-10-3 appears in our catalog under these names: 2-(tert-Butyl(nitroso)amino)-1-(3-chlorophenyl)propan-1-one, >95% (HPLC), N-NITROSO BUPROPION SOLUTION, N-NITROSO BUPROPION. Offered by: TRC, Sigma-Aldrich. Available pack sizes: 250mg, 500mg, 50mg, 1ML, 25MG.
N-tert-butyl-N-[1-(3-chlorophenyl)-1-oxopropan-2-yl]nitrous amide (CAS 2763780-10-3) is a chemical compound with the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. IUPAC name: N-tert-butyl-N-[1-(3-chlorophenyl)-1-oxopropan-2-yl]nitrous amide. InChIKey: IPHMVIXBRCCXRJ-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O2 |
|---|---|
| Molecular weight | 268.74 g/mol |
| IUPAC name | N-tert-butyl-N-[1-(3-chlorophenyl)-1-oxopropan-2-yl]nitrous amide |
| InChIKey | IPHMVIXBRCCXRJ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=CC=C1)Cl)N(C(C)(C)C)N=O |
Computed by PubChem (NCBI)