Products 2764732-27-4
CAS 2764732-27-4 is the registry number for 4-Chloro-1-(1-ethoxyethyl)-3,5-dimethyl-1H-pyrazole, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
4-chloro-1-(1-ethoxyethyl)-3,5-dimethylpyrazole (CAS 2764732-27-4) is a chemical compound with the molecular formula C9H15ClN2O and a molecular weight of 202.68 g/mol. IUPAC name: 4-chloro-1-(1-ethoxyethyl)-3,5-dimethylpyrazole. InChIKey: YCQOLOSOWGUGJV-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN2O |
|---|---|
| Molecular weight | 202.68 g/mol |
| IUPAC name | 4-chloro-1-(1-ethoxyethyl)-3,5-dimethylpyrazole |
| InChIKey | YCQOLOSOWGUGJV-UHFFFAOYSA-N |
| SMILES | CCOC(C)N1C(=C(C(=N1)C)Cl)C |
Computed by PubChem (NCBI)