Products 2764733-49-3
CAS 2764733-49-3 is the registry number for 2-(2-Bromo-5-chloro-4-methoxyphenyl)-2-methyl-1,3-dioxolane, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-(2-bromo-5-chloro-4-methoxyphenyl)-2-methyl-1,3-dioxolane (CAS 2764733-49-3) is a chemical compound with the molecular formula C11H12BrClO3 and a molecular weight of 307.57 g/mol. IUPAC name: 2-(2-bromo-5-chloro-4-methoxyphenyl)-2-methyl-1,3-dioxolane. InChIKey: GONLJDCPPJOBJL-UHFFFAOYSA-N.
| Molecular formula | C11H12BrClO3 |
|---|---|
| Molecular weight | 307.57 g/mol |
| IUPAC name | 2-(2-bromo-5-chloro-4-methoxyphenyl)-2-methyl-1,3-dioxolane |
| InChIKey | GONLJDCPPJOBJL-UHFFFAOYSA-N |
| SMILES | CC1(OCCO1)C2=CC(=C(C=C2Br)OC)Cl |
Computed by PubChem (NCBI)